5-Methyl-1,3-benzenedicarboxylic acid
5-Methyl-1,3-benzenedicarboxylic acid
CAS: 499-49-0
Molecular Formula: C9H8O4
5-Methyl-1,3-benzenedicarboxylic acid - Names and Identifiers
| Name | 5-Methyl-1,3-benzenedicarboxylic acid |
| Synonyms | Uvitic acid UVITIC ACID RARECHEM AL BO 1540 TIMTEC-BB SBB008429 5-methylisophthalic acid 5-METHYLISOPHTHALIC ACID 5-METHYL-1,3-BENZOIC ACID 5-methylbenzene-1,3-dicarboxylate 5-Ethyl-1,3-BenzenedicarboxylicAcid 5-METHYL-1,3-BENZENEDICARBOXYLIC ACID 5-METHYLBENZENE-1,3-DICARBOXYLIC ACID 5-Methylbenzene-1,3-dicarboxylic acid 5-Methyl-1,3-benzenedicarboxylic acid |
| CAS | 499-49-0 |
| EINECS | 207-881-2 |
| InChI | InChI=1/C9H8O4/c1-5-2-6(8(10)11)4-7(3-5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13)/p-2 |
5-Methyl-1,3-benzenedicarboxylic acid - Physico-chemical Properties
| Molecular Formula | C9H8O4 |
| Molar Mass | 180.16 |
| Density | 1.377±0.06 g/cm3(Predicted) |
| Melting Point | 299-303°C(lit.) |
| Boling Point | 408.7±33.0 °C(Predicted) |
| Flash Point | 215.1°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 2.06E-07mmHg at 25°C |
| Appearance | White powder |
| Color | White to Light yellow to Green |
| pKa | 3.60±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD00013986 |
5-Methyl-1,3-benzenedicarboxylic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| HS Code | 29173990 |
| Hazard Note | Irritant |
5-Methyl-1,3-benzenedicarboxylic acid - Introduction
5-Methyl-1,3-benzenedicarboxylic acid is an organic compound with the chemical formula C9H8O4. It is also known as 5-Methylisophthalic acid or 5-Me-IPA.
The following are some of the properties of 5-Methyl-1,3-benzenedicarboxylic acid:
1. Appearance: white crystalline solid.
2. Solubility: Soluble in water and organic solvents, such as alcohols and ketones.
3. melting point: about 250-255 degrees Celsius.
4. chemical properties: it is an acidic substance, can react with alkali to form a salt. It can also participate in esterification reactions and aromatic substitution reactions.
5-Methyl-1,3-benzenedicarboxylic acid has many applications in the chemical industry:
1. Synthesis of high-performance polyester: As one of the raw materials, it is used to synthesize high-performance polyester resin for the preparation of beverage bottles, fibers, coatings and plastic products.
2. Pharmaceutical field: It can be used to prepare some drugs and drug intermediates, with anti-cancer and anti-inflammatory potential.
3. dyes and pigments: can be used as organic dyes and pigments synthesis intermediates.
The common method for preparing 5-Methyl-1,3-benzenedicarboxylic acid is through aromatic substitution reaction of toluene. The specific preparation method includes iodination, chlorination or methylation reaction of toluene, and then through oxidation and acid hydrolysis to prepare the target product.
Regarding the security information of 5-Methyl-1,3-benzenedicarboxylic acid, the following points need to be noted:
1. Avoid direct contact with skin, eyes and respiratory tract. Appropriate protective equipment such as gloves, safety glasses and protective masks should be worn.
2. in use should be in a well-ventilated place to avoid inhalation of its steam.
3. if accidentally inhaled or contact, should be immediately cleaned or sent to a doctor for treatment.
4. It should be stored in a dry, cool and sealed container, away from fire and oxidizing agents.
The following are some of the properties of 5-Methyl-1,3-benzenedicarboxylic acid:
1. Appearance: white crystalline solid.
2. Solubility: Soluble in water and organic solvents, such as alcohols and ketones.
3. melting point: about 250-255 degrees Celsius.
4. chemical properties: it is an acidic substance, can react with alkali to form a salt. It can also participate in esterification reactions and aromatic substitution reactions.
5-Methyl-1,3-benzenedicarboxylic acid has many applications in the chemical industry:
1. Synthesis of high-performance polyester: As one of the raw materials, it is used to synthesize high-performance polyester resin for the preparation of beverage bottles, fibers, coatings and plastic products.
2. Pharmaceutical field: It can be used to prepare some drugs and drug intermediates, with anti-cancer and anti-inflammatory potential.
3. dyes and pigments: can be used as organic dyes and pigments synthesis intermediates.
The common method for preparing 5-Methyl-1,3-benzenedicarboxylic acid is through aromatic substitution reaction of toluene. The specific preparation method includes iodination, chlorination or methylation reaction of toluene, and then through oxidation and acid hydrolysis to prepare the target product.
Regarding the security information of 5-Methyl-1,3-benzenedicarboxylic acid, the following points need to be noted:
1. Avoid direct contact with skin, eyes and respiratory tract. Appropriate protective equipment such as gloves, safety glasses and protective masks should be worn.
2. in use should be in a well-ventilated place to avoid inhalation of its steam.
3. if accidentally inhaled or contact, should be immediately cleaned or sent to a doctor for treatment.
4. It should be stored in a dry, cool and sealed container, away from fire and oxidizing agents.
Last Update：2024-04-09 19:05:49
Supplier List
Spot supply
Product Name: 5-Methylisophthalic Acid Visit Supplier Webpage Request for quotationCAS: 499-49-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 5-Methylisophthalic Acid Visit Supplier Webpage Request for quotationCAS: 499-49-0
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History